Arry-380 10mM * 1mL in DMSO
ARRY-380 is an ErbB-2 inhibitor that selectively binds to and inhibits the phosphorylation of ErbB-2, resulting in growth inhibition and death of ErbB-2-expressing tumor cells.
| Trivial name | Arry-380 10mM * 1mL in DMSO |
| Catalog Number | A11027-10mM-D |
| Alternative Name(s) | 6-[5-[[[2-(Methylsulfonyl)ethyl]amino]methyl]-2-furanyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-4-quinazolinamine |
| Molecular Formula | C29H27N7O4S |
| CAS# | 937265-83-3 |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=NC3=C2C=C(C=C3)C4=CC=C(O4)CNCCS(=O)(=O)C)OC5=CC6=NC=NN6C=C5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/arry-380.html |