WZ4002 10mM * 1mL in DMSO
WZ4002 is EGFR inhibitor against EGFR T790M (mutation of the gatekeeper T790 residue) which is detected in 50% of clinically resistant patients to gefitinib or erlotinib.
| Trivial name | WZ4002 10mM * 1mL in DMSO |
| Catalog Number | A10991-10mM-D |
| Alternative Name(s) | N-[3-[[5-Chloro-2-[[2-methoxy-4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]oxy]phenyl]-2-propenamide |
| Molecular Formula | C25H27ClN6O3 |
| CAS# | 1213269-23-8 |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wz4002.html |
