WP1130 5mg
WP1130 (Degrasyn) is a novel selective small molecular deubiquitinase inhibitor and a Bcr/Abl destruction pathway activator that specifically and rapidly down-regulates both wild-type and mutant Bcr/Abl protein without affecting bcr/abl gene expression in chronic myelogenous leukemia (CML) cells.
Trivial name | WP1130 5mg |
Catalog Number | A10988-5 |
Alternative Name(s) | (2E)-3-(6-Bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]-2-propenamide |
Molecular Formula | C19H18BrN3O |
CAS# | 856243-80-6 |
SMILES | CCC[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=NC(=CC=C2)Br)/C#N |
Size | 5mg |
Supplier Page | http://www.adooq.com/wp1130.html |