VX-765 10mM * 1mL in DMSO
VX-765 is a novel Caspase-1 inhibitor,which is an enzyme that controls the generation of two cytokines, IL-1b and IL-18.
Trivial name | VX-765 10mM * 1mL in DMSO |
Catalog Number | A10984-10mM-D |
Alternative Name(s) | (S)-1-((S)-2-{[1-(4-amino-3-chloro-phenyl)-methanoyl]-amino}-3,3-dimethyl-butanoyl)-pyrrolidine-2-carboxylic acid ((2R,3S)-2-ethoxy-5-oxo-tetrahydro-furan-3-yl)-amide |
Molecular Formula | C24H33ClN4O6 |
CAS# | 273404-37-8 |
SMILES | CCO[C@H]1[C@H](CC(=O)O1)NC(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)(C)C)NC(=O)C3=CC(=C(C=C3)N)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/vx-765.html |