Vinflunine Tartrate 10mM * 1mL in DMSO
Vinflunine Tartrate is a tartrate salt of vinflunine that destabilizes microtubules with an IC50 of 18.8 nM and interferes with the dynamics of microtubules during cell division.
Trivial name | Vinflunine Tartrate 10mM * 1mL in DMSO |
Catalog Number | A10975-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C₄₅H₅₄F₂N₄O₈.xC₄H₆O₆ |
CAS# | 1201898-17-0 |
SMILES | CC[C@@]12C=CCN3[C@@H]1[C@]4(CC3)[C@H]([C@]([C@@H]2OC(=O)C)(C(=O)OC)O)N(C5=CC(=C(C=C45)[C@]6(C[C@H]7C[C@H](CN(C7)CC8=C6NC9=CC=CC=C89)C(C)(F)F)C(=O)OC)OC)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/vinflunine-tartrate.html |