Vicriviroc Malate 100mg
Vicriviroc Malate is a second generation orally active CCR5 antagonist, which is also a potent inhibitor of HIV-1 entry into target cells, with a mean IC50 =0.46 nM and IC50 =1~10 nM to HIV isolates (n=52).
| Trivial name | Vicriviroc Malate 100mg |
| Catalog Number | A10971-100 |
| Alternative Name(s) | 1-[(4,6-Dimethyl-5-pyrimidinyl)carbonyl]-4-[(3S)-4-[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methyl-1-piperazinyl]-4-methylpiperidine malate |
| Molecular Formula | C28H38F3N5O2.C4H6O5 |
| CAS# | 541503-81-5 |
| SMILES | C[C@H]1CN(CCN1[C@@H](COC)C2=CC=C(C=C2)C(F)(F)F)C3(CCN(CC3)C(=O)C4=C(N=CN=C4C)C)C.C(C(C(=O)O)O)C(=O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/vicriviroc-malate.html |
