Ursolic acid 200mg
Ursolic acid(Malol) is a pentacyclic triterpene acid, used in cosmetics, that is also capable of inhibiting various types of cancer cells by inhibiting the STAT3 activation pathway and human fibrosarcoma cells by reducing the expression of matrix metalloproteinase-9 by acting through the glucocorticoid receptor.
| Trivial name | Ursolic acid 200mg |
| Catalog Number | A10961-200 |
| Alternative Name(s) | 3??-?€?hydroxy-?€?urs-?€?12-?€?en-?€?28-?€?oic acid |
| Molecular Formula | C30H48O3 |
| CAS# | 77-52-1 |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/ursolic-acid-malol.html |