Tubacin 10mM * 1mL in DMSO
Tubacin (tubulin acetylation inducer) is a highly potent and selective, reversible, cell-permeable HDAC6 inhibitor with an IC50 of 4 nM.
Trivial name | Tubacin 10mM * 1mL in DMSO |
Catalog Number | A10954-10mM-D |
Alternative Name(s) | N1-(4-((2R,4R,6S)-4-(((4,5-diphenyloxazol-2-yl)thio)methyl)-6-(4-(hydroxymethyl)phenyl)-1,3-dioxan-2-yl)phenyl)-N8-hydroxyoctanediamide |
Molecular Formula | C41H43N3O7S |
CAS# | 537049-40-4 |
SMILES | C1[C@@H](O[C@@H](O[C@@H]1C2=CC=C(C=C2)CO)C3=CC=C(C=C3)NC(=O)CCCCCCC(=O)NO)CSC4=NC(=C(O4)C5=CC=CC=C5)C6=CC=CC=C6 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/tubacin.html |