TSU-68 (SU6668) 10mM * 1mL in DMSO
TSU-68 (SU-6668) is an inhibitor of RTKs involved in VEGF, bFGF and PDGF signaling, which inhibits endothelial cell proliferation.
| Trivial name | TSU-68 (SU6668) 10mM * 1mL in DMSO |
| Catalog Number | A10953-10mM-D |
| Alternative Name(s) | 5-[1,2-Dihydro-2-oxo-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-propanoic acid |
| Molecular Formula | C18H18N2O3 |
| CAS# | 252916-29-3 |
| SMILES | CC1=C(NC(=C1CCC(=O)O)C)/C=C2/C3=CC=CC=C3NC2=O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tsu-68-su6668.html |
