Troxerutin 10mM * 1mL in DMSO
Troxerutin(Trihydroxyethylrutin) is a flavonol, a type of flavonoid. It is more accurately a hydroxyethylrutoside. It can be isolated from Sophora japonica, the japanese pagoda tree.It is used as a vasoprotective.
Trivial name | Troxerutin 10mM * 1mL in DMSO |
Catalog Number | A10952-10mM-D |
Alternative Name(s) | Trihydroxyethylrutin; 3',4',7-Tris[O-(2-hydroxyethyl)]rutin |
Molecular Formula | C33H42O19 |
CAS# | 7085-55-4 |
SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OCCO)C5=CC(=C(C=C5)OCCO)OCCO)O)O)O)O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/troxerutin.html |