Tolterodine tartrate 10mM * 1mL in DMSO
Tolterodine tartrate (Detrol LA) is a muscarinic receptor antagonist which is used for the treatment of urinary incontinence.
Trivial name | Tolterodine tartrate 10mM * 1mL in DMSO |
Catalog Number | A10937-10mM-D |
Alternative Name(s) | (+)-R)-2-{a-[2-(Diisopropylamino)ethyl]benzyl}-p-cresol tartrate |
Molecular Formula | C26H37NO7 |
CAS# | 124937-52-6 |
SMILES | CC1=CC(=C(C=C1)O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/tolterodine-tartrate-detrol-la.html |