Tigecycline 10mg
Tigecycline is bacteriostatic and is a protein synthesis inhibitor by binding to the 30S ribosomal subunit of bacteria and thereby blocking entry of Aminoacyl-tRNA into the A site of the ribosome during prokaryotic translation.
| Trivial name | Tigecycline 10mg |
| Catalog Number | A10933-10 |
| Alternative Name(s) | N-[(5aR,6aS,7S,9Z,10aS)-9-[amino(hydroxy)methylidene]-4,7-bis(dimethylamino)-1,10a,12-trihydroxy-8,10,11-trioxo-5,5a,6,6a,7,8,9,10,10a,11-decahydrotetracen-2-yl]-2-(tert-butylamino)acetamide |
| Molecular Formula | C29H39N5O8 |
| CAS# | 220620-09-7 |
| SMILES | CC(C)(C)NCC(=O)NC1=C(C2=C(C[C@H]3C[C@H]4[C@@H](C(=O)C(=C([C@]4(C(=O)C3=C2O)O)O)C(=O)N)N(C)C)C(=C1)N(C)C)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/tigecycline.html |
