Tie2 kinase inhibitor 10mM * 1mL in DMSO
Tie2 kinase inhibitor is a potent and selective Tie2 inhibitor with IC50 of 0.25 ??M.
Trivial name | Tie2 kinase inhibitor 10mM * 1mL in DMSO |
Catalog Number | A10932-10mM-D |
Alternative Name(s) | 4-(6-Methoxy-2-naphthyl)-2-(4-methylsulfinylphenyl)-5-(4-pyridyl)-1H-imidazole |
Molecular Formula | C26H21N3O2S |
CAS# | 948557-43-5 |
SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C3=C(NC(=N3)C4=CC=C(C=C4)S(=O)C)C5=CC=NC=C5 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/tie2-kinase-inhibitor.html |