Temsirolimus (Torisel) 10mM * 1mL in DMSO
Temsirolimus is a specific inhibitor of mTOR and interferes with the synthesis of proteins that regulate proliferation, growth, and survival of tumor cells.
Trivial name | Temsirolimus (Torisel) 10mM * 1mL in DMSO |
Catalog Number | A10906-10mM-D |
Alternative Name(s) | Rapamycin 42-[3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
Molecular Formula | C56H87NO16 |
CAS# | 162635-04-3 |
SMILES | C[C@@H]1CC[C@H]2C[C@@H](/C(=C/C=CC=C[C@H](C[C@H](C(=O)[C@H]([C@H](/C(=C[C@H](C(=O)C[C@H](OC(=O)[C@@H]3CCCCN3C(=O)C(=O)[C@@]1(O2)O)[C@@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)OC(=O)C(C)(CO)CO)C)/C)O)OC)C)C)/C)OC |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/temsirolimus-torisel.html |