Tangeretin 100mg
Tangeretin (Tangeritin) is an O-polymethoxylated flavone that is found in tangerine and other citrus peels. Tangeretin (Tangeritin) strengthens the cell wall and acts as a plant’s defensive mechanism against disease-causing pathogens. Tangeretin (Tangeritin) also shows enormous potential as an anti cancer agent.
| Trivial name | Tangeretin 100mg |
| Catalog Number | A10888-100 |
| Alternative Name(s) | 5,6,7,8-tetramethoxy-2- (4-methoxyphenyl)-4H- 1-benzopyran-4-one |
| Molecular Formula | C20H20O7 |
| CAS# | 481-53-8 |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/tangeretin-tangeritin.html |
