Streptozotocin 1g
Streptozotocin (Streptozocin, Zanosar, STZ)is used in medical research to produce an animal model for Type 1 diabetes, which directly inhibist the O-GlcNAcase activity of the enzyme NCOAT in vitro.
| Trivial name | Streptozotocin 1g |
| Catalog Number | A10868-1000 |
| Alternative Name(s) | 2-deoxy-2-({[methyl(nitroso)amino]carbonyl}amino)-??-D-glucopyranose |
| Molecular Formula | C8H15N3O7 |
| CAS# | 18883-66-4 |
| SMILES | CN(C(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1O)CO)O)O)N=O |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/streptozotocin-zanosar.html |
