STF-62247 10mg
STF-62247 is a small molecule agonist that induces autophagy and selectively causes lethality in renal cell carcinoma (RCC) cells that have lost the von Hippel-Lindau (VHL) tumor suppressor activity (IC50 = 625 nM).
| Trivial name | STF-62247 10mg |
| Catalog Number | A10866-10 |
| Alternative Name(s) | N-?€?(3-?€?methylphenyl)-?€?4-?€?(4-?€?pyridinyl)-?€?2-?€?thiazolamine |
| Molecular Formula | C15H13N3S |
| CAS# | 315702-99-9 |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=CS2)C3=CC=NC=C3 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/stf-62247.html |
