Silibinin (Silybin) 10mM * 1mL in DMSO
Silibinin (silybin) is the major active constituent of silymarina compound extracted from the seeds of the herb milk thistle.
| Trivial name | Silibinin (Silybin) 10mM * 1mL in DMSO |
| Catalog Number | A10842-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C25H22O10 |
| CAS# | 22888-70-6 |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H](OC3=C(O2)C=C(C=C3)[C@@H]4[C@H](C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/silibinin-silybin.html |