SB 525334 100mg
SB525334 is a selective inhibitor of transforming growth factor-?? receptor I (ALK5, TGF-??RI) (IC50 = 14.3 nM). Inhibits TGF-??1-induced smad2/3 nuclear localization and TGF-??RI-induced mRNA expression in kidney cells
| Trivial name | SB 525334 100mg |
| Catalog Number | A10827-100 |
| Alternative Name(s) | N/A |
| Molecular Formula | C21H21N5 |
| CAS# | 356559-20-1 |
| SMILES | CC1=CC=CC(=N1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=NC=CN=C4C=C3 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/sb-525334.html |
