SB 203580 10mM * 1mL in DMSO
SB 203580 is a specific inhibitor of p38?? and p38?? which suppresses downstream activation of MAPKAP kinase-2 and heat shock protein 27.
Trivial name | SB 203580 10mM * 1mL in DMSO |
Catalog Number | A10824-10mM-D |
Alternative Name(s) | 4-[4-(4-fluorophenyl)-2-(4-methylsulfinylphenyl)-1H-imidazol-5-yl]pyridine |
Molecular Formula | C₂₁H₁₆FN₃OS |
CAS# | 152121-47-6 |
SMILES | CS(=O)C1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sb-203580.html |