Rutin (Rutoside) 10mM * 1mL in DMSO
Rutin is one of the phenolic compounds found in the invasive plant species Carpobrotus edulis and contributes to the antibacterial and antioxidant properties of the plant
| Trivial name | Rutin (Rutoside) 10mM * 1mL in DMSO |
| Catalog Number | A10815-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C27H30O16 |
| CAS# | 153-18-4 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rutin-rutoside.html |
