Rivaroxaban (Xarelto) 10mM * 1mL in DMSO
Rivaroxaban is an oxazolidinone derivative optimized for inhibiting both free Factor Xa and Factor Xa bound in the prothrombinase complex.
Trivial name | Rivaroxaban (Xarelto) 10mM * 1mL in DMSO |
Catalog Number | A10800-10mM-D |
Alternative Name(s) | (S)-5-chloro-N-{[2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]oxazolidin-5-yl]methyl} thiophene-2-carboxamide |
Molecular Formula | C19H18ClN3O5S |
CAS# | 366789-02-8 |
SMILES | C1COCC(=O)N1C2=CC=C(C=C2)N3C[C@@H](OC3=O)CNC(=O)C4=CC=C(S4)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/rivaroxaban.html |