Ritonavir 25mg
Ritonavir is a protease inhibitor with activity against Human Immunodeficiency Virus Type 1 (HIV-1). Protease inhibitors block the part of HIV called protease.Ritonavir inhibits the HIV viral proteinase enzyme which prevents cleavage of the gag-pol polyprotein, resulting in noninfectious, immature viral particles.
Trivial name | Ritonavir 25mg |
Catalog Number | A10799-25 |
Alternative Name(s) | N/A |
Molecular Formula | C37H48N6O5S2 |
CAS# | 155213-67-5 |
SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=CC=CC=C2)C[C@@H]([C@H](CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)O |
Size | 25mg |
Supplier Page | http://www.adooq.com/ritonavir.html |