Ritonavir 10mg
Ritonavir is a protease inhibitor with activity against Human Immunodeficiency Virus Type 1 (HIV-1). Protease inhibitors block the part of HIV called protease.Ritonavir inhibits the HIV viral proteinase enzyme which prevents cleavage of the gag-pol polyprotein, resulting in noninfectious, immature viral particles.
| Trivial name | Ritonavir 10mg |
| Catalog Number | A10799-10 |
| Alternative Name(s) | N/A |
| Molecular Formula | C37H48N6O5S2 |
| CAS# | 155213-67-5 |
| SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=CC=CC=C2)C[C@@H]([C@H](CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/ritonavir.html |
