Rifaximin (Xifaxan) 1000mg
Rifaximin is a semisynthetic, rifamycin-based non-systemic antibiotic, meaning that very little of the drug will pass the gastrointestinal wall into the circulation as is common for other types of orally administered antibiotics.
| Trivial name | Rifaximin (Xifaxan) 1000mg |
| Catalog Number | A10793-1000 |
| Alternative Name(s) | 2S-Acetyloxy-5,6,21,23-tetrahydroxy-27-methoxy-2,4,11, 16,20,22,24,26-octamethyl-2,7-(epoxypentoeleca(1,11,13)trienimino)benzofuro[4,5-e]pyride[1,2-a]benzimidazole-1,15(2H)-dione |
| Molecular Formula | C43H51N3O11 |
| CAS# | 80621-81-4 |
| SMILES | C[C@H]1/C=C/C=C(C(=O)NC2=C(C3=C(C4=C(C(=C3O)C)O[C@@](C4=O)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C5=C2N6C=CC(=CC6=N5)C)O)/C |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/rifaximin-xifaxan.html |
