Pizotifen malate 10mM * 1mL in DMSO
Pizotifen malate, a derivative of benzocycloheptathiophene, is a tricyclic compound found to be a potent inhibitor of SR-2 receptor activity.
| Trivial name | Pizotifen malate 10mM * 1mL in DMSO |
| Catalog Number | A10738-10mM-D |
| Alternative Name(s) | 9,10-Dihydro-4-(1-methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene malate (1:1) |
| Molecular Formula | C19H21NS.C4H6O5 |
| CAS# | 5189-11-7 |
| SMILES | CN1CCC(=C2C3=C(CCC4=CC=CC=C42)SC=C3)CC1.C(C(C(=O)O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pizotifen-malate.html |