Pimecrolimus 10mM * 1mL in DMSO
Pimecrolimus is a natural ascomycin macrolactam that binds to macrophilin-12 (FKBP-12) and inhibits calcineurin as well as prolyl isomerase (rotamase).
Trivial name | Pimecrolimus 10mM * 1mL in DMSO |
Catalog Number | A10732-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C₄₃H₆₈ClNO₁₁ |
CAS# | 137071-32-0 |
SMILES | CC[C@@H]1/C=C(C[C@@H](C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC1=O)O)C)/C(=C/[C@@H]4CC[C@@H]([C@@H](C4)OC)Cl)/C)O)C)OC)OC)C)/C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pimecrolimus.html |