PIK-93 10mM * 1mL in DMSO
PIK 93 selectively inhibits the type III PI 4-kinase enzyme, and small interfering RNA-mediated down-regulation of the individual PI 4-kinase enzymes.
| Trivial name | PIK-93 10mM * 1mL in DMSO |
| Catalog Number | A10731-10mM-D |
| Alternative Name(s) | N-[5-[4-Chloro-3-[[(2-hydroxyethyl)amino]sulfonyl]phenyl]-4-methyl-2-thiazolyl]acetamide |
| Molecular Formula | C14H16ClN3O4S2 |
| CAS# | 593960-11-3 |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C2=CC(=C(C=C2)Cl)S(=O)(=O)NCCO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pik-93.html |
