PIK-293 10mM * 1mL in DMSO
PIK-293 is a PI3-K inhibitor. PIK-293 inhibits the p110??, p110??, p110??. PIK-293 is the parent compound of PIK-294.
| Trivial name | PIK-293 10mM * 1mL in DMSO |
| Catalog Number | A10727-10mM-D |
| Alternative Name(s) | 2-[(4-Amino-1H-pyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-methyl-3-(2-methylphenyl)-4(3H)-quinazolinone |
| Molecular Formula | C22H19N7O |
| CAS# | 900185-01-5 |
| SMILES | CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)CN4C5=C(C=N4)C(=NC=N5)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pik-293.html |
