Phloretin 10mM * 1mL in DMSO
Phloretin inhibits the active transport of glucose into cells by SGLT1 and SGLT2, though the inhibition is weaker than by its glycoside phlorizin.
| Trivial name | Phloretin 10mM * 1mL in DMSO |
| Catalog Number | A10723-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C15H14O5 |
| CAS# | 60-82-2 |
| SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/phloretin-dihydronaringenin.html |