Phenformin HCl 10mM * 1mL in DMSO
Phenformin hydrochloride is a hydrochloride salt of phenformin from the biguanide drug class that displays anti-diabetic activity.
| Trivial name | Phenformin HCl 10mM * 1mL in DMSO |
| Catalog Number | A10717-10mM-D |
| Alternative Name(s) | 1-Phenethylbiguanide hydrochloride |
| Molecular Formula | C10H15N5.HCl;C10H16ClN5 |
| CAS# | 834-28-6 |
| SMILES | C1=CC=C(C=C1)CCN=C(N)N=C(N)N.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/phenformin-hydrochloride.html |