Pemetrexed 200mg
Pemetrexed is chemically similar to folic acid and is in the class of chemotherapy drugs called folate antimetabolites. It works by inhibiting three enzymes used in purine and pyrimidine synthesis?€?thymidylate synthase (TS), dihydrofolate reductase (DHFR), and glycinamide ribonucleotide formyltransferase.
Trivial name | Pemetrexed 200mg |
Catalog Number | A10707-200 |
Alternative Name(s) | (2S)-2-{[4-[2-(2-amino-4-oxo-1,7-dihydro pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino} pentanedioic acid |
Molecular Formula | C20H19N5Na2O6 |
CAS# | 150399-23-8 |
SMILES | C1=CC(=CC=C1CCC2=CNC3=C2C(=O)N=C(N3)N)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Size | 200mg |
Supplier Page | http://www.adooq.com/pemetrexed-alimta.html |