Pazopanib Hydrochloride 10mg
Pazopanib is a potent and selective multi-targeted receptor tyrosine kinase inhibitor of VEGFR-1, VEGFR-2, VEGFR-3, PDGFR-a/??, and c-kit that blocks tumor growth and inhibits angiogenesis.
| Trivial name | Pazopanib Hydrochloride 10mg |
| Catalog Number | A10699-10 |
| Alternative Name(s) | N/A |
| Molecular Formula | C21H23N7O2S.HCl |
| CAS# | 635702-64-6 |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/pazopanib-hydrochloride.html |
