OSI-930 25mg
OSI-930 is a potent inhibitor of Kit, KDR, Flt, CSF-1R, c-Raf and Lck with IC50 of 80 nM, 9 nM, 8 nM, 15 nM, 41 nM and 22 nM, respectively.
| Trivial name | OSI-930 25mg |
| Catalog Number | A10679-25 |
| Alternative Name(s) | 3-[(4-Quinolinylmethyl)amino]-N-[4-(trifluoromethoxy)phenyl]-2-thiophenecarboxamide |
| Molecular Formula | C22H16F3N3O2S |
| CAS# | 728033-96-3 |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)CNC3=C(SC=C3)C(=O)NC4=CC=C(C=C4)OC(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/osi-930.html |
