OSI-420 10mM * 1mL in DMSO
OSI-420 (Desmethyl Erlotinib,CP-473420) is an orally active EGFR tyrosin kinase inhibitor, which inhibits receptor tyrosine kinases (TKs) by inhibition of the intercellular domain .
| Trivial name | OSI-420 10mM * 1mL in DMSO |
| Catalog Number | A10678-10mM-D |
| Alternative Name(s) | 2-[[4-[(3-Ethynylphenyl)amino]-7-(2-methoxyethoxy)-6-quinazolinyl]oxy]ethanol hydrochloride |
| Molecular Formula | C21H21N3O4.HCl |
| CAS# | 183320-51-6 |
| SMILES | COCCOC1=C(C=C2C(=C1)N=CN=C2NC3=CC=CC(=C3)C#C)OCCO.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/osi-420.html |
