ON-01910 10mM * 1mL in DMSO
ON-01910 is selectively cytotoxic for chronic lymphocytic leukemia cells through a dual mechanism of action involving PI3K/AKT inhibition and induction of oxidative stress.
| Trivial name | ON-01910 10mM * 1mL in DMSO |
| Catalog Number | A10673-10mM-D |
| Alternative Name(s) | N-[2-Methoxy-5-[[[2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl]methyl]phenyl]glycine sodium salt |
| Molecular Formula | C21H24NNaO8S |
| CAS# | 1225497-78-8 |
| SMILES | COC1=C(C=C(C=C1)CS(=O)(=O)/C=C/C2=C(C=C(C=C2OC)OC)OC)NCC(=O)[O-].[Na+] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/on-01910.html |
