AUY922 25mg
AUY922 (NVP-AUY922) is highly potent and oral inhibitor of Hsp90 with IC50=21 nM in Hsp90 FP binding assay and inhibits proliferation of various human cancer cell lines in vitro, with GI50 average 9 nM.
| Trivial name | AUY922 25mg |
| Catalog Number | A10659-25 |
| Alternative Name(s) | 5-(2,4-Dihydroxy-5-isopropylphenyl)-N-ethyl-4-(4-(morpholinomethyl)phenyl)isoxazole-3-carboxamide |
| Molecular Formula | C26H31N3O5 |
| CAS# | 747412-49-3 |
| SMILES | CCNC(=O)C1=C(/C(=C/2C=C(C(=CC2=O)O)C(C)C)/ON1)C3=CC=C(C=C3)CN4CCOCC4 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/auy922-nvp-auy922.html |
