Nobiletin 50mg
Nobiletin is a chemical compound. It is an O-methylated flavone, a flavonoid isolated from citrus peels like in tangerine. Nobiletin was found to have anti-inflammatory and anti-tumor invasion, proliferation, and metastasis in vitro and in vivo. Nobiletin was also found to potentially inhibit cartilage degradation.
| Trivial name | Nobiletin 50mg |
| Catalog Number | A10651-50 |
| Alternative Name(s) | 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
| Molecular Formula | C21H22O8 |
| CAS# | 478-01-3 |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)OC |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/nobiletin-hexamethoxyflavone.html |
