Naproxen sodium 500mg
Naproxen sodium is a non-selective cyclooxygenase (COX) inhibitor that displays anti-inflammatory, antipyretic and analgesic effects. Has a neuroprotective role against colchicine-induced cognitive impairment and oxidative stress.
| Trivial name | Naproxen sodium 500mg |
| Catalog Number | A10623-500 |
| Alternative Name(s) | (2S)-2-(6-Methoxy-2-naphthyl)propan?oic acid sodium salt |
| Molecular Formula | C14H13NaO3 |
| CAS# | 26159-34-2 |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)[O-].[Na+] |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/naproxen-sodium.html |
