Nafamostat mesylate 10mM * 1mL in DMSO
Nafamostat is an anticoagulant. Broad spectrum serine protease inhibitor. Reduces eosinophil infiltration, mast cell activation and airway responsiveness in a murine model of asthma.
| Trivial name | Nafamostat mesylate 10mM * 1mL in DMSO |
| Catalog Number | A10617-10mM-D |
| Alternative Name(s) | 6-Amidino-2-naphthyl 4-guanidino-benzoate dimethanesulphonate |
| Molecular Formula | C19H17N5O2.2CH4O3S |
| CAS# | 82956-11-4 |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/nafamostat-mesylate.html |
