Mycophenolate mofetil 10mM * 1mL in DMSO
Mycophenolate mofetil is a reversible inhibitor of inosine monophosphate dehydrogenase (IMPDH) in purine biosynthesis (specifically guanine synthesis) which is necessary for the growth of T cells and B cells.
| Trivial name | Mycophenolate mofetil 10mM * 1mL in DMSO |
| Catalog Number | A10613-10mM-D |
| Alternative Name(s) | 6-[(7-Hydroxy-5-methoxy-4-methyl-1-oxo-3H-isobenzofuran-6-yl)]-4-methyl-hex-4-enoic acid 2-morpholinoethyl ester |
| Molecular Formula | C23H31NO7 |
| CAS# | 128794-94-5 |
| SMILES | CC1=C(C(=C(C2=C1COC2=O)O)C/C=C(C)/CCC(=O)OCCN3CCOCC3)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mycophenolate-mofetil-cellcept.html |
