Mifepristone (Mifeprex) 10mM * 1mL in DMSO
Mifepristone, an antioxidant and glucocorticoid receptor antagonist, demonstrates the ability to suppress activation of NF??B, a nuclear transcription factor that affects the expression of various adhesion molecules and several inflammatory genes.
Trivial name | Mifepristone (Mifeprex) 10mM * 1mL in DMSO |
Catalog Number | A10591-10mM-D |
Alternative Name(s) | 11b-[p-(Dimethylamino)phenyl]-17b-hydroxy-17-(1-propynyl)estra-4,9-dien-3-one |
Molecular Formula | C29H35NO2 |
CAS# | 84371-65-3 |
SMILES | CC#C[C@@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/mifepristone-mifeprex.html |