MGCD-265 50mg
MGCD265 is a multitargeted tyrosine kinase inhibitor that binds to and inhibits the phosphorylation of several RTKs, including the c-Met receptor (HGFR); the Tek/Tie-2 receptor; VEGFR types 1, 2, and 3; and MST1R.
| Trivial name | MGCD-265 50mg |
| Catalog Number | A10587-50 |
| Alternative Name(s) | N-(3-Fluoro-4-(2-(1-methyl-1H-imidazol-4-yl)thieno[3,2-b]pyridin-7-yloxy)phenylcarbamothioyl)-2-phenylacetamide |
| Molecular Formula | C26H20FN5O2S2 |
| CAS# | 875337-44-3 |
| SMILES | CN1C=C(N=C1)C2=CC3=NC=CC(=C3S2)OC4=C(C=C(C=C4)NC(=S)NC(=O)CC5=CC=CC=C5)F |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/mgcd-265.html |
