Metolazone 10mM * 1mL in DMSO
Metolazone and the other thiazide diuretics inhibit the function of the sodium-chloride symporter and prevent sodium and chloride, water as well, from leaving the lumen to enter the tubule cell.
| Trivial name | Metolazone 10mM * 1mL in DMSO |
| Catalog Number | A10584-10mM-D |
| Alternative Name(s) | 7-chloro-2-methyl-4-oxo-3-o-tolyl-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
| Molecular Formula | C16H16ClN3O3S |
| CAS# | 17560-51-9 |
| SMILES | CC1NC2=CC(=C(C=C2C(=O)N1C3=CC=CC=C3C)S(=O)(=O)N)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/metolazone.html |