Methylprednisolone 10mM * 1mL in DMSO
Methylprednisolone is an apoptosis inducer and was also found to inhibit human small cell lung cancer cell growth in vitro.
| Trivial name | Methylprednisolone 10mM * 1mL in DMSO |
| Catalog Number | A10582-10mM-D |
| Alternative Name(s) | 11b,17a,21-Trihydroxy-6a-methyl-1,4-pregnene-3,20-dione; 6alpha-Methyl-1,4-pregnadiene-11beta,17alpha,21-triol-3,20-dione; 6alpha-Methylprednisolone; Medrol; Medrone |
| Molecular Formula | C22H30O5 |
| CAS# | 83-43-2 |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/methylprednisolone.html |