Maraviroc (UK-427857) 10mM * 1mL in DMSO
Maraviroc is an antiretroviral drug in the CCR5 receptor antagonist class used in the treatment of HIV infection.
| Trivial name | Maraviroc (UK-427857) 10mM * 1mL in DMSO |
| Catalog Number | A10556-10mM-D |
| Alternative Name(s) | 4,4-difluoro-N-{(1S)-3-[3-(3-isopropyl- 5-methyl-4H-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]oct-8-yl]-1-phenylpropyl}cyclohexanecarboxamide |
| Molecular Formula | C29H41F2N5O |
| CAS# | 376348-65-1 |
| SMILES | CC1=NN=C(N1C2C[C@H]3CC[C@@H](C2)N3CC[C@@H](C4=CC=CC=C4)NC(=O)C5CCC(CC5)(F)F)C(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/maraviroc.html |
