Manidipine dihydrochloride 10mM * 1mL in DMSO
Manidipine 2HCl is a HCl salt form of Manidipine which is a calcium channel blocker for Ca2+ current with IC50 of 2.6 nM.
| Trivial name | Manidipine dihydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A10554-10mM-D |
| Alternative Name(s) | 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid 2-[4-(diphenylmethyl)-1-piperazinyl]ethyl methyl ester hydrochloride |
| Molecular Formula | C35H40Cl2N4O6 |
| CAS# | 89226-75-5 |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN2CCN(CC2)C(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC(=CC=C5)[N+](=O)[O-])C(=O)OC.Cl.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/manidipine-dihydrochloride.html |
