LY2784544 10mM * 1mL in DMSO
LY2784544 is identified as being highly selective for JAK2-V617F and has advanced into human clinical trials for the treatment of several myeloproliferative disorders.
| Trivial name | LY2784544 10mM * 1mL in DMSO |
| Catalog Number | A10546-10mM-D |
| Alternative Name(s) | 3-[(4-Chloro-2-fluorophenyl)methyl]-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)-8-(4-morpholinylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| Molecular Formula | C23H25ClFN7O |
| CAS# | 1229236-86-5 |
| SMILES | CC1=CC(=NN1)NC2=NN3C(=C(N=C3C(=C2)CN4CCOCC4)C)CC5=C(C=C(C=C5)Cl)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ly2784544.html |
