LY2140023 5mg
LY-404039 is a drug used in scientific research that acts as a selective agonist for the metabotropic glutamate receptor group II subtypes mGluR2 and mGluR3. It has anxiolytic and antipsychotic effects in animal studies, but without causing sedation. Early human trials using a prodrug form of LY-404,039 called LY-214,0023 have also given encouraging results.
| Trivial name | LY2140023 5mg |
| Catalog Number | A10544-5 |
| Alternative Name(s) | (1R,4S,5S,6S)-4-Amino-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid 2,2-dioxide |
| Molecular Formula | C7H9NO6S |
| CAS# | 635318-11-5 |
| SMILES | C1[C@]([C@@H]2[C@H]([C@@H]2S1(=O)=O)C(=O)O)(C(=O)O)N |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/ly2140023-ly404039.html |
