Luteolin 10mM * 1mL in DMSO
Luteolin is a PDE4 inhibitor, phosphodiesterase inhibitor, and an interleukin 6 inhibitor, affecting xylazine/ketamine-induced anesthesia in mice. Luteolin acts as a monoamine transporter activator, and is one of the few chemicals demonstrated to possess this property.
| Trivial name | Luteolin 10mM * 1mL in DMSO |
| Catalog Number | A10541-10mM-D |
| Alternative Name(s) | 2-(3,4-Dihydroxyphenyl)- 5,7-dihydroxy-4-chromenone |
| Molecular Formula | C15H10O6 |
| CAS# | 491-70-3 |
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/luteolin.html |
